instruction stringlengths 41 142 | input stringlengths 0 478 | output stringlengths 4 382 |
|---|---|---|
Provide the SMILES representation for the building block token <BB_0>. | C=CCc1ccc(F)c(C)c1 | |
What is the building block token for the following molecule? | C=CCc1ccc(F)c(C)c1 | <BB_0> |
What is the molecular formula for <BB_0>? | The molecular formula for <BB_0> (C=CCc1ccc(F)c(C)c1) is C10H11F. | |
Describe the ring structures in building block <BB_0>. | The molecule contains 1 ring(s): an aromatic ring of size 6. | |
List the primary functional groups present in <BB_0>. | The molecule contains the following groups: Halogen (F,Cl,Br,I). | |
Provide a comprehensive chemical profile for the building block <BB_0>. | **Token:** <BB_0>
**SMILES:** C=CCc1ccc(F)c(C)c1
**Molecular Formula:** C10H11F
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Halogen (F,Cl,Br,I) | |
Provide the SMILES representation for the building block token <BB_1>. | CC(C)(c1ccc(C=O)cc1)C(F)(F)F | |
What is the building block token for the following molecule? | CC(C)(c1ccc(C=O)cc1)C(F)(F)F | <BB_1> |
What is the molecular formula for <BB_1>? | The molecular formula for <BB_1> (CC(C)(c1ccc(C=O)cc1)C(F)(F)F) is C11H11F3O. | |
Describe the ring structures in building block <BB_1>. | The molecule contains 1 ring(s): an aromatic ring of size 6. | |
List the primary functional groups present in <BB_1>. | The molecule contains the following groups: Aldehyde, Halogen (F,Cl,Br,I). | |
Provide a comprehensive chemical profile for the building block <BB_1>. | **Token:** <BB_1>
**SMILES:** CC(C)(c1ccc(C=O)cc1)C(F)(F)F
**Molecular Formula:** C11H11F3O
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Aldehyde, Halogen (F,Cl,Br,I) | |
Provide the SMILES representation for the building block token <BB_2>. | CCNC(=O)NC(C)(C)C(=O)O | |
What is the building block token for the following molecule? | CCNC(=O)NC(C)(C)C(=O)O | <BB_2> |
What is the molecular formula for <BB_2>? | The molecular formula for <BB_2> (CCNC(=O)NC(C)(C)C(=O)O) is C7H14N2O3. | |
Describe the ring structures in building block <BB_2>. | The molecule is acyclic (contains no rings). | |
List the primary functional groups present in <BB_2>. | The molecule contains the following groups: Carboxylic Acid, Amide. | |
Provide a comprehensive chemical profile for the building block <BB_2>. | **Token:** <BB_2>
**SMILES:** CCNC(=O)NC(C)(C)C(=O)O
**Molecular Formula:** C7H14N2O3
**Ring System:** The molecule is acyclic (contains no rings).
**Functional Groups:** Carboxylic Acid, Amide | |
Provide the SMILES representation for the building block token <BB_3>. | CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)O)cc1 | |
What is the building block token for the following molecule? | CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)O)cc1 | <BB_3> |
What is the molecular formula for <BB_3>? | The molecular formula for <BB_3> (CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)O)cc1) is C13H19NO4S. | |
Describe the ring structures in building block <BB_3>. | The molecule contains 1 ring(s): an aromatic ring of size 6. | |
List the primary functional groups present in <BB_3>. | The molecule contains the following groups: Carboxylic Acid, Secondary Amine, Sulfonamide. | |
Provide a comprehensive chemical profile for the building block <BB_3>. | **Token:** <BB_3>
**SMILES:** CC(C)(C)c1ccc(S(=O)(=O)NCCC(=O)O)cc1
**Molecular Formula:** C13H19NO4S
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Carboxylic Acid, Secondary Amine, Sulfonamide | |
Provide the SMILES representation for the building block token <BB_4>. | COC(=O)c1cc(Br)ccc1C | |
What is the building block token for the following molecule? | COC(=O)c1cc(Br)ccc1C | <BB_4> |
What is the molecular formula for <BB_4>? | The molecular formula for <BB_4> (COC(=O)c1cc(Br)ccc1C) is C9H9BrO2. | |
Describe the ring structures in building block <BB_4>. | The molecule contains 1 ring(s): an aromatic ring of size 6. | |
List the primary functional groups present in <BB_4>. | The molecule contains the following groups: Ester, Ether, Halogen (F,Cl,Br,I). | |
Provide a comprehensive chemical profile for the building block <BB_4>. | **Token:** <BB_4>
**SMILES:** COC(=O)c1cc(Br)ccc1C
**Molecular Formula:** C9H9BrO2
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Ester, Ether, Halogen (F,Cl,Br,I) | |
Provide the SMILES representation for the building block token <BB_5>. | COC(=O)C(N)C(O)C(C)C.Cl | |
What is the building block token for the following molecule? | COC(=O)C(N)C(O)C(C)C.Cl | <BB_5> |
What is the molecular formula for <BB_5>? | The molecular formula for <BB_5> (COC(=O)C(N)C(O)C(C)C.Cl) is C7H16ClNO3. | |
Describe the ring structures in building block <BB_5>. | The molecule is acyclic (contains no rings). | |
List the primary functional groups present in <BB_5>. | The molecule contains the following groups: Amine, Ester, Alcohol, Ether, Halogen (F,Cl,Br,I). | |
Provide a comprehensive chemical profile for the building block <BB_5>. | **Token:** <BB_5>
**SMILES:** COC(=O)C(N)C(O)C(C)C.Cl
**Molecular Formula:** C7H16ClNO3
**Ring System:** The molecule is acyclic (contains no rings).
**Functional Groups:** Amine, Ester, Alcohol, Ether, Halogen (F,Cl,Br,I) | |
Provide the SMILES representation for the building block token <BB_6>. | Cn1cc(C=O)c(-c2ccccc2)n1 | |
What is the building block token for the following molecule? | Cn1cc(C=O)c(-c2ccccc2)n1 | <BB_6> |
What is the molecular formula for <BB_6>? | The molecular formula for <BB_6> (Cn1cc(C=O)c(-c2ccccc2)n1) is C11H10N2O. | |
Describe the ring structures in building block <BB_6>. | The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6. | |
List the primary functional groups present in <BB_6>. | The molecule contains the following groups: Aldehyde. | |
Provide a comprehensive chemical profile for the building block <BB_6>. | **Token:** <BB_6>
**SMILES:** Cn1cc(C=O)c(-c2ccccc2)n1
**Molecular Formula:** C11H10N2O
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aromatic ring of size 6.
**Functional Groups:** Aldehyde | |
Provide the SMILES representation for the building block token <BB_7>. | CN(C1CCCCC1)C1CCCCC1 | |
What is the building block token for the following molecule? | CN(C1CCCCC1)C1CCCCC1 | <BB_7> |
What is the molecular formula for <BB_7>? | The molecular formula for <BB_7> (CN(C1CCCCC1)C1CCCCC1) is C13H25N. | |
Describe the ring structures in building block <BB_7>. | The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6. | |
List the primary functional groups present in <BB_7>. | The molecule contains the following groups: Tertiary Amine. | |
Provide a comprehensive chemical profile for the building block <BB_7>. | **Token:** <BB_7>
**SMILES:** CN(C1CCCCC1)C1CCCCC1
**Molecular Formula:** C13H25N
**Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 6, an aliphatic ring of size 6.
**Functional Groups:** Tertiary Amine | |
Provide the SMILES representation for the building block token <BB_8>. | C#CCC1(C(=O)Cl)CCCCC1 | |
What is the building block token for the following molecule? | C#CCC1(C(=O)Cl)CCCCC1 | <BB_8> |
What is the molecular formula for <BB_8>? | The molecular formula for <BB_8> (C#CCC1(C(=O)Cl)CCCCC1) is C10H13ClO. | |
Describe the ring structures in building block <BB_8>. | The molecule contains 1 ring(s): an aliphatic ring of size 6. | |
List the primary functional groups present in <BB_8>. | The molecule contains the following groups: Halogen (F,Cl,Br,I). | |
Provide a comprehensive chemical profile for the building block <BB_8>. | **Token:** <BB_8>
**SMILES:** C#CCC1(C(=O)Cl)CCCCC1
**Molecular Formula:** C10H13ClO
**Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6.
**Functional Groups:** Halogen (F,Cl,Br,I) | |
Provide the SMILES representation for the building block token <BB_9>. | CCn1nccc1C1CCNCC1 | |
What is the building block token for the following molecule? | CCn1nccc1C1CCNCC1 | <BB_9> |
What is the molecular formula for <BB_9>? | The molecular formula for <BB_9> (CCn1nccc1C1CCNCC1) is C10H17N3. | |
Describe the ring structures in building block <BB_9>. | The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. | |
List the primary functional groups present in <BB_9>. | The molecule contains the following groups: Secondary Amine. | |
Provide a comprehensive chemical profile for the building block <BB_9>. | **Token:** <BB_9>
**SMILES:** CCn1nccc1C1CCNCC1
**Molecular Formula:** C10H17N3
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
**Functional Groups:** Secondary Amine | |
Provide the SMILES representation for the building block token <BB_10>. | CCCCC(=CCO)CCCC | |
What is the building block token for the following molecule? | CCCCC(=CCO)CCCC | <BB_10> |
What is the molecular formula for <BB_10>? | The molecular formula for <BB_10> (CCCCC(=CCO)CCCC) is C11H22O. | |
Describe the ring structures in building block <BB_10>. | The molecule is acyclic (contains no rings). | |
List the primary functional groups present in <BB_10>. | The molecule contains the following groups: Alcohol. | |
Provide a comprehensive chemical profile for the building block <BB_10>. | **Token:** <BB_10>
**SMILES:** CCCCC(=CCO)CCCC
**Molecular Formula:** C11H22O
**Ring System:** The molecule is acyclic (contains no rings).
**Functional Groups:** Alcohol | |
Provide the SMILES representation for the building block token <BB_11>. | CC(F)(F)CCCO | |
What is the building block token for the following molecule? | CC(F)(F)CCCO | <BB_11> |
What is the molecular formula for <BB_11>? | The molecular formula for <BB_11> (CC(F)(F)CCCO) is C5H10F2O. | |
Describe the ring structures in building block <BB_11>. | The molecule is acyclic (contains no rings). | |
List the primary functional groups present in <BB_11>. | The molecule contains the following groups: Alcohol, Halogen (F,Cl,Br,I). | |
Provide a comprehensive chemical profile for the building block <BB_11>. | **Token:** <BB_11>
**SMILES:** CC(F)(F)CCCO
**Molecular Formula:** C5H10F2O
**Ring System:** The molecule is acyclic (contains no rings).
**Functional Groups:** Alcohol, Halogen (F,Cl,Br,I) | |
Provide the SMILES representation for the building block token <BB_12>. | CCC(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1 | |
What is the building block token for the following molecule? | CCC(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1 | <BB_12> |
What is the molecular formula for <BB_12>? | The molecular formula for <BB_12> (CCC(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1) is C9H8Cl2O3S. | |
Describe the ring structures in building block <BB_12>. | The molecule contains 1 ring(s): an aromatic ring of size 6. | |
List the primary functional groups present in <BB_12>. | The molecule contains the following groups: Ketone, Halogen (F,Cl,Br,I). | |
Provide a comprehensive chemical profile for the building block <BB_12>. | **Token:** <BB_12>
**SMILES:** CCC(=O)c1ccc(Cl)c(S(=O)(=O)Cl)c1
**Molecular Formula:** C9H8Cl2O3S
**Ring System:** The molecule contains 1 ring(s): an aromatic ring of size 6.
**Functional Groups:** Ketone, Halogen (F,Cl,Br,I) | |
Provide the SMILES representation for the building block token <BB_13>. | COCC1(N)CCC(F)(F)CC1.Cl | |
What is the building block token for the following molecule? | COCC1(N)CCC(F)(F)CC1.Cl | <BB_13> |
What is the molecular formula for <BB_13>? | The molecular formula for <BB_13> (COCC1(N)CCC(F)(F)CC1.Cl) is C8H16ClF2NO. | |
Describe the ring structures in building block <BB_13>. | The molecule contains 1 ring(s): an aliphatic ring of size 6. | |
List the primary functional groups present in <BB_13>. | The molecule contains the following groups: Amine, Ether, Halogen (F,Cl,Br,I). | |
Provide a comprehensive chemical profile for the building block <BB_13>. | **Token:** <BB_13>
**SMILES:** COCC1(N)CCC(F)(F)CC1.Cl
**Molecular Formula:** C8H16ClF2NO
**Ring System:** The molecule contains 1 ring(s): an aliphatic ring of size 6.
**Functional Groups:** Amine, Ether, Halogen (F,Cl,Br,I) | |
Provide the SMILES representation for the building block token <BB_14>. | Cn1c(N2CCNCC2)nc(Cl)c1C#N | |
What is the building block token for the following molecule? | Cn1c(N2CCNCC2)nc(Cl)c1C#N | <BB_14> |
What is the molecular formula for <BB_14>? | The molecular formula for <BB_14> (Cn1c(N2CCNCC2)nc(Cl)c1C#N) is C9H12ClN5. | |
Describe the ring structures in building block <BB_14>. | The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6. | |
List the primary functional groups present in <BB_14>. | The molecule contains the following groups: Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitrile. | |
Provide a comprehensive chemical profile for the building block <BB_14>. | **Token:** <BB_14>
**SMILES:** Cn1c(N2CCNCC2)nc(Cl)c1C#N
**Molecular Formula:** C9H12ClN5
**Ring System:** The molecule contains 2 ring(s): an aromatic ring of size 5, an aliphatic ring of size 6.
**Functional Groups:** Secondary Amine, Tertiary Amine, Halogen (F,Cl,Br,I), Nitrile | |
Provide the SMILES representation for the building block token <BB_15>. | CC1Cc2cccc(CN)c2N1 | |
What is the building block token for the following molecule? | CC1Cc2cccc(CN)c2N1 | <BB_15> |
What is the molecular formula for <BB_15>? | The molecular formula for <BB_15> (CC1Cc2cccc(CN)c2N1) is C10H14N2. | |
Describe the ring structures in building block <BB_15>. | The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6. | |
List the primary functional groups present in <BB_15>. | The molecule contains the following groups: Amine, Secondary Amine. | |
Provide a comprehensive chemical profile for the building block <BB_15>. | **Token:** <BB_15>
**SMILES:** CC1Cc2cccc(CN)c2N1
**Molecular Formula:** C10H14N2
**Ring System:** The molecule contains 2 ring(s): an aliphatic ring of size 5, an aromatic ring of size 6.
**Functional Groups:** Amine, Secondary Amine | |
Provide the SMILES representation for the building block token <BB_16>. | Fc1ccc(CCN2CCNCC2)cc1 | |
What is the building block token for the following molecule? | Fc1ccc(CCN2CCNCC2)cc1 | <BB_16> |
What is the molecular formula for <BB_16>? | The molecular formula for <BB_16> (Fc1ccc(CCN2CCNCC2)cc1) is C12H17FN2. | |
Describe the ring structures in building block <BB_16>. | The molecule contains 2 ring(s): an aromatic ring of size 6, an aliphatic ring of size 6. |
End of preview. Expand in Data Studio
No dataset card yet
- Downloads last month
- 13